CAS 1228880-32-7 appears in our catalog under these names: (5-Phenyl-1,3,4-thiadiazol-2-yl)methanamine hydrochloride, 95%, (5-Phenyl-1,3,4-thiadiazol-2-yl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(5-phenyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride (CAS 1228880-32-7) is a chemical compound with the molecular formula C9H10ClN3S and a molecular weight of 227.71 g/mol. IUPAC name: (5-phenyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride. InChIKey: BSFKTKMNWYASNP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3S |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | (5-phenyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride |
| InChIKey | BSFKTKMNWYASNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)CN.Cl |
Computed by PubChem (NCBI)