CAS 942-31-4 is the registry number for Amiphenazole Hydrochloride. Offered by: LoGiCal. Available pack sizes: 10mg.
5-phenyl-1,3-thiazole-2,4-diamine;hydrochloride (CAS 942-31-4) is a chemical compound with the molecular formula C9H10ClN3S and a molecular weight of 227.71 g/mol. IUPAC name: 5-phenyl-1,3-thiazole-2,4-diamine;hydrochloride. InChIKey: AGSXNJJBDIOXIP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3S |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | 5-phenyl-1,3-thiazole-2,4-diamine;hydrochloride |
| InChIKey | AGSXNJJBDIOXIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)N)N.Cl |
Computed by PubChem (NCBI)