Products 1071935-18-6
CAS 1071935-18-6 is the registry number for 2,4-Dimethyl-N-Phenyl-N-(P-Tolyl)Aniline, 99.9%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
2,4-dimethyl-N-(4-methylphenyl)-N-phenylaniline (CAS 1071935-18-6) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: 2,4-dimethyl-N-(4-methylphenyl)-N-phenylaniline. InChIKey: AKPKRGCTFSWQPK-UHFFFAOYSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2,4-dimethyl-N-(4-methylphenyl)-N-phenylaniline |
| InChIKey | AKPKRGCTFSWQPK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=CC=C2)C3=C(C=C(C=C3)C)C |
Computed by PubChem (NCBI)