CAS 1071989-48-4 appears in our catalog under these names: 2-Chloro-4-(hydroxymethyl)benzoic Acid, 2-Chloro-4-(hydroxymethyl)benzoic acid 98%, 2-Chloro-4-(hydroxymethyl)benzoic acid, 98%, 2-Chloro-4-(Hydroxymethyl)Benzoic Acid, 98%, 98%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-chloro-4-(hydroxymethyl)benzoic acid (CAS 1071989-48-4) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-4-(hydroxymethyl)benzoic acid. InChIKey: CENHHWTWQDGWKP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-4-(hydroxymethyl)benzoic acid |
| InChIKey | CENHHWTWQDGWKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)Cl)C(=O)O |
Computed by PubChem (NCBI)