Products 1072449-62-7

CAS 1072449-62-7 is the registry number for 2-Amino-2-(3-methylphenyl)acetic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-amino-2-(3-methylphenyl)acetic acid;hydrochloride (CAS 1072449-62-7) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2-amino-2-(3-methylphenyl)acetic acid;hydrochloride. InChIKey: LWJTVGAVWMCIKT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO2
Molecular weight201.65 g/mol
IUPAC name2-amino-2-(3-methylphenyl)acetic acid;hydrochloride
InChIKeyLWJTVGAVWMCIKT-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)