CAS 1072944-58-1 is the registry number for 3,8-Dibromo-6-methylimidazo[1,2-a]pyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3,8-dibromo-6-methylimidazo[1,2-a]pyridine (CAS 1072944-58-1) is a chemical compound with the molecular formula C8H6Br2N2 and a molecular weight of 289.95 g/mol. IUPAC name: 3,8-dibromo-6-methylimidazo[1,2-a]pyridine. InChIKey: HWOBYRIEVQZDGR-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2 |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 3,8-dibromo-6-methylimidazo[1,2-a]pyridine |
| InChIKey | HWOBYRIEVQZDGR-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=CN=C2C(=C1)Br)Br |
Computed by PubChem (NCBI)