CAS 1844-42-4 appears in our catalog under these names: 4,6-Dibromo-2-methyl-1H-benzo[d]imidazole 97%, 4,6-Dibromo-2-methyl-1H-benzo[d]imidazole, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,6-dibromo-2-methyl-1H-benzimidazole (CAS 1844-42-4) is a chemical compound with the molecular formula C8H6Br2N2 and a molecular weight of 289.95 g/mol. IUPAC name: 4,6-dibromo-2-methyl-1H-benzimidazole. InChIKey: MINIPXKMVMBPQD-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2 |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 4,6-dibromo-2-methyl-1H-benzimidazole |
| InChIKey | MINIPXKMVMBPQD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2Br)Br |
Computed by PubChem (NCBI)