CAS 1785486-67-0 appears in our catalog under these names: 1,3-Dibromo-7-methylimidazo(1,5-a)pyridine, 95%, 1,3-Dibromo-7-methylimidazo(1,5-a)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1,3-dibromo-7-methylimidazo[1,5-a]pyridine (CAS 1785486-67-0) is a chemical compound with the molecular formula C8H6Br2N2 and a molecular weight of 289.95 g/mol. IUPAC name: 1,3-dibromo-7-methylimidazo[1,5-a]pyridine. InChIKey: ZJZCFUNXJYDCCD-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2 |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 1,3-dibromo-7-methylimidazo[1,5-a]pyridine |
| InChIKey | ZJZCFUNXJYDCCD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C(N2C=C1)Br)Br |
Computed by PubChem (NCBI)