CAS 89664-13-1 appears in our catalog under these names: 5,6-Dibromo-2-methyl-1h-benzo[d]imidazole, 95%, 5,6-Dibromo-2-methyl-1H-benzo(d)imidazole, 97%, 5,6–Dibromo–2–methyl–1H–benzo(d)imidazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
5,6-dibromo-2-methyl-1H-benzimidazole (CAS 89664-13-1) is a chemical compound with the molecular formula C8H6Br2N2 and a molecular weight of 289.95 g/mol. IUPAC name: 5,6-dibromo-2-methyl-1H-benzimidazole. InChIKey: VRHINYYCVCHKEF-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2 |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 5,6-dibromo-2-methyl-1H-benzimidazole |
| InChIKey | VRHINYYCVCHKEF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2N1)Br)Br |
Computed by PubChem (NCBI)