CAS 52088-11-6 appears in our catalog under these names: 3,5-Dibromo-1-methyl-1H-indazole, 98%, 98%, 3,5-Dibromo-1-methyl-1H-indazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g.
3,5-dibromo-1-methylindazole (CAS 52088-11-6) is a chemical compound with the molecular formula C8H6Br2N2 and a molecular weight of 289.95 g/mol. IUPAC name: 3,5-dibromo-1-methylindazole. InChIKey: GWDBUVLBDCQJIY-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2 |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 3,5-dibromo-1-methylindazole |
| InChIKey | GWDBUVLBDCQJIY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C(=N1)Br |
Computed by PubChem (NCBI)