CAS 2368911-22-0 is the registry number for 4,5-Dibromo-6-methyl-1H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dibromo-6-methyl-1H-indazole (CAS 2368911-22-0) is a chemical compound with the molecular formula C8H6Br2N2 and a molecular weight of 289.95 g/mol. IUPAC name: 4,5-dibromo-6-methyl-1H-indazole. InChIKey: WBJPTXBSTCWRCF-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2 |
|---|---|
| Molecular weight | 289.95 g/mol |
| IUPAC name | 4,5-dibromo-6-methyl-1H-indazole |
| InChIKey | WBJPTXBSTCWRCF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=NN2)C(=C1Br)Br |
Computed by PubChem (NCBI)