CAS 1072944-80-9 is the registry number for Methyl 4-(3-chlorophenyl)-2-methylthiazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-(3-chlorophenyl)-2-methyl-1,3-thiazole-5-carboxylate (CAS 1072944-80-9) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: methyl 4-(3-chlorophenyl)-2-methyl-1,3-thiazole-5-carboxylate. InChIKey: GIJNEWPJPSPLDK-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2S |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | methyl 4-(3-chlorophenyl)-2-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | GIJNEWPJPSPLDK-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C(=O)OC)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)