CAS 7454-47-9 appears in our catalog under these names: 4-Chloro-n-phenylbenzenesulfonamide, 95%, 4-Chloro-N-phenylbenzenesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
4-chloro-N-phenylbenzenesulfonamide (CAS 7454-47-9) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: 4-chloro-N-phenylbenzenesulfonamide. InChIKey: ISOSXVUVKUIPHF-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2S |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | 4-chloro-N-phenylbenzenesulfonamide |
| InChIKey | ISOSXVUVKUIPHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)