CAS 17969-38-9 is the registry number for Methyl 2-(2-(4-chlorophenyl)thiazol-4-yl)acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate (CAS 17969-38-9) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: methyl 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate. InChIKey: MJGJGPMQTCOMSC-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2S |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | methyl 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| InChIKey | MJGJGPMQTCOMSC-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CSC(=N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)