CAS 1225504-35-7 is the registry number for [2-(2-Chlorobenzyl)-1,3-thiazol-4-yl]acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[2-[(2-chlorophenyl)methyl]-1,3-thiazol-4-yl]acetic acid (CAS 1225504-35-7) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: 2-[2-[(2-chlorophenyl)methyl]-1,3-thiazol-4-yl]acetic acid. InChIKey: WFIYSPPNIFDKSL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2S |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | 2-[2-[(2-chlorophenyl)methyl]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | WFIYSPPNIFDKSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NC(=CS2)CC(=O)O)Cl |
Computed by PubChem (NCBI)