Products 132089-36-2

CAS 132089-36-2 is the registry number for 2-(2-Chloro-phenyl)-thiazole-4-carboxylic acid ethyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate (CAS 132089-36-2) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: ethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: FHKIJGQXQOGHAL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10ClNO2S
Molecular weight267.73 g/mol
IUPAC nameethyl 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylate
InChIKeyFHKIJGQXQOGHAL-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)C2=CC=CC=C2Cl

Computed by PubChem (NCBI)