CAS 154220-01-6 is the registry number for Methyl 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylate (CAS 154220-01-6) is a chemical compound with the molecular formula C12H10ClNO2S and a molecular weight of 267.73 g/mol. IUPAC name: methyl 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylate. InChIKey: GNSVTQODPXNWEG-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2S |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | methyl 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylate |
| InChIKey | GNSVTQODPXNWEG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)