Products 2768871-83-4
CAS 2768871-83-4 is the registry number for 2,4-Dichloro-5,6,7,8-tetrahydro-5,8-methanoquinoline-3-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile (CAS 2768871-83-4) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 4,6-dichloro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile. InChIKey: JRMQANWIOQPCQU-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 4,6-dichloro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-5-carbonitrile |
| InChIKey | JRMQANWIOQPCQU-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C3=C2N=C(C(=C3Cl)C#N)Cl |
Computed by PubChem (NCBI)