CAS 120758-42-1 is the registry number for Sulconazole Nitrate Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(E)-2-(2,4-dichlorophenyl)ethenyl]imidazole (CAS 120758-42-1) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 1-[(E)-2-(2,4-dichlorophenyl)ethenyl]imidazole. InChIKey: MJHPYOROBKVNFJ-HWKANZROSA-N.
| Molecular formula | C11H8Cl2N2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 1-[(E)-2-(2,4-dichlorophenyl)ethenyl]imidazole |
| InChIKey | MJHPYOROBKVNFJ-HWKANZROSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)/C=C/N2C=CN=C2 |
Computed by PubChem (NCBI)