Products 120758-42-1

CAS 120758-42-1 is the registry number for Sulconazole Nitrate Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-[(E)-2-(2,4-dichlorophenyl)ethenyl]imidazole (CAS 120758-42-1) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 1-[(E)-2-(2,4-dichlorophenyl)ethenyl]imidazole. InChIKey: MJHPYOROBKVNFJ-HWKANZROSA-N.

Identity
Molecular formulaC11H8Cl2N2
Molecular weight239.10 g/mol
IUPAC name1-[(E)-2-(2,4-dichlorophenyl)ethenyl]imidazole
InChIKeyMJHPYOROBKVNFJ-HWKANZROSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)/C=C/N2C=CN=C2

Computed by PubChem (NCBI)