CAS 1357165-68-4 appears in our catalog under these names: 6-(2,4-Dichlorophenyl)pyridin-3-amine, 95%, 6-(2,4-Dichlorophenyl)pyridin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-(2,4-dichlorophenyl)pyridin-3-amine (CAS 1357165-68-4) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 6-(2,4-dichlorophenyl)pyridin-3-amine. InChIKey: OZOBVDOLHBOFCE-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 6-(2,4-dichlorophenyl)pyridin-3-amine |
| InChIKey | OZOBVDOLHBOFCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)