Products 1073617-84-1
CAS 1073617-84-1 is the registry number for (R)-1-(5,6-Dichloropyridin-3-yl)ethane-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(5,6-dichloro-3-pyridinyl)ethane-1,2-diol (CAS 1073617-84-1) is a chemical compound with the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. IUPAC name: (1R)-1-(5,6-dichloro-3-pyridinyl)ethane-1,2-diol. InChIKey: NGIAOOMOOSRHSK-LURJTMIESA-N.
| Molecular formula | C7H7Cl2NO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | (1R)-1-(5,6-dichloro-3-pyridinyl)ethane-1,2-diol |
| InChIKey | NGIAOOMOOSRHSK-LURJTMIESA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)[C@H](CO)O |
Computed by PubChem (NCBI)