CAS 1198-07-8 appears in our catalog under these names: methyl 3,5-dichloro-1-methyl-1H-pyrrole-2-carboxylate, 95%, methyl 3,5-dichloro-1-methyl-1H-pyrrole-2-carboxylate, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g.
Methyl 3,5-dichloro-1-methylpyrrole-2-carboxylate (CAS 1198-07-8) is a chemical compound with the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. IUPAC name: methyl 3,5-dichloro-1-methylpyrrole-2-carboxylate. InChIKey: SNBXSPQWPWFKBD-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | methyl 3,5-dichloro-1-methylpyrrole-2-carboxylate |
| InChIKey | SNBXSPQWPWFKBD-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=C1C(=O)OC)Cl)Cl |
Computed by PubChem (NCBI)