Products 93043-49-3
CAS 93043-49-3 is the registry number for 4-Amino-2-chlorobenzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-amino-2-chlorobenzoic acid;hydrochloride (CAS 93043-49-3) is a chemical compound with the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. IUPAC name: 4-amino-2-chlorobenzoic acid;hydrochloride. InChIKey: ATKCBPBSFTYMAB-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 4-amino-2-chlorobenzoic acid;hydrochloride |
| InChIKey | ATKCBPBSFTYMAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)