CAS 1351479-18-9 appears in our catalog under these names: Methyl 4–chloronicotinate hydrochloride, Methyl 4-chloronicotinate hydrochloride, 95%, 95%, Methyl 4-chloronicotinate hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
Methyl 4-chloropyridine-3-carboxylate;hydrochloride (CAS 1351479-18-9) is a chemical compound with the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. IUPAC name: methyl 4-chloropyridine-3-carboxylate;hydrochloride. InChIKey: AUWPABULCGRBCE-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | methyl 4-chloropyridine-3-carboxylate;hydrochloride |
| InChIKey | AUWPABULCGRBCE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CN=C1)Cl.Cl |
Computed by PubChem (NCBI)