CAS 2229182-20-9 is the registry number for 1-(2,6-Dichloropyridin-4-yl)ethane-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-dichloro-4-pyridinyl)ethane-1,2-diol (CAS 2229182-20-9) is a chemical compound with the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. IUPAC name: 1-(2,6-dichloro-4-pyridinyl)ethane-1,2-diol. InChIKey: DAIKGGLMICNGJE-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 1-(2,6-dichloro-4-pyridinyl)ethane-1,2-diol |
| InChIKey | DAIKGGLMICNGJE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)C(CO)O |
Computed by PubChem (NCBI)