Products 1688656-71-4
CAS 1688656-71-4 is the registry number for 2-(4-Chloropyridin-2-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(4-chloro-2-pyridinyl)acetic acid;hydrochloride (CAS 1688656-71-4) is a chemical compound with the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. IUPAC name: 2-(4-chloro-2-pyridinyl)acetic acid;hydrochloride. InChIKey: KUHDAVNYDNXCAM-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 2-(4-chloro-2-pyridinyl)acetic acid;hydrochloride |
| InChIKey | KUHDAVNYDNXCAM-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)CC(=O)O.Cl |
Computed by PubChem (NCBI)