CAS 107445-46-5 is the registry number for 5-Chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid (CAS 107445-46-5) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid. InChIKey: IDRJLNSCIBUCLZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid |
| InChIKey | IDRJLNSCIBUCLZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N2C1=NN=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)