CAS 107466-19-3 is the registry number for 5-Phenyl-6-thioxo-1,2,5,6-tetrahydro-4H-pyrazolo[3,4-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-phenyl-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one (CAS 107466-19-3) is a chemical compound with the molecular formula C11H8N4OS and a molecular weight of 244.27 g/mol. IUPAC name: 5-phenyl-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one. InChIKey: PLUVWHRAFOQZME-UHFFFAOYSA-N.
| Molecular formula | C11H8N4OS |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 5-phenyl-6-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | PLUVWHRAFOQZME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=C(NC2=S)NN=C3 |
Computed by PubChem (NCBI)