Products 123518-02-5
CAS 123518-02-5 is the registry number for 2,6-Diamino-4-(2-furyl)-4h-thiopyran-3,5-dicarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,6-diamino-4-(furan-2-yl)-4H-thiopyran-3,5-dicarbonitrile (CAS 123518-02-5) is a chemical compound with the molecular formula C11H8N4OS and a molecular weight of 244.27 g/mol. IUPAC name: 2,6-diamino-4-(furan-2-yl)-4H-thiopyran-3,5-dicarbonitrile. InChIKey: CKVCOHNMMGJPQE-UHFFFAOYSA-N.
| Molecular formula | C11H8N4OS |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2,6-diamino-4-(furan-2-yl)-4H-thiopyran-3,5-dicarbonitrile |
| InChIKey | CKVCOHNMMGJPQE-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2C(=C(SC(=C2C#N)N)N)C#N |
Computed by PubChem (NCBI)