CAS 848833-13-6 is the registry number for 4-Cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide (CAS 848833-13-6) is a chemical compound with the molecular formula C11H8N4OS and a molecular weight of 244.27 g/mol. IUPAC name: 4-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide. InChIKey: ROVOFTXTTOCBCE-UHFFFAOYSA-N.
| Molecular formula | C11H8N4OS |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 4-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
| InChIKey | ROVOFTXTTOCBCE-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(S1)NC(=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)