CAS 1538150-99-0 is the registry number for 5-(5-Phenyl-1,3,4-oxadiazol-2-yl)thiazol-2-amine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-2-amine (CAS 1538150-99-0) is a chemical compound with the molecular formula C11H8N4OS and a molecular weight of 244.27 g/mol. IUPAC name: 5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-2-amine. InChIKey: QYVJNGCQMMWYSX-UHFFFAOYSA-N.
| Molecular formula | C11H8N4OS |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 5-(5-phenyl-1,3,4-oxadiazol-2-yl)-1,3-thiazol-2-amine |
| InChIKey | QYVJNGCQMMWYSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C3=CN=C(S3)N |
Computed by PubChem (NCBI)