CAS 156718-77-3 appears in our catalog under these names: 6-Mercapto-1-phenyl-1,5-dihydro-4h-pyrazolo[3,4-d]pyrimidin-4-one, 95%, 1-Phenyl-6-sulfanyl-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
1-phenyl-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 156718-77-3) is a chemical compound with the molecular formula C11H8N4OS and a molecular weight of 244.27 g/mol. IUPAC name: 1-phenyl-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: GQGJEOSQNGTTOM-UHFFFAOYSA-N.
| Molecular formula | C11H8N4OS |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 1-phenyl-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | GQGJEOSQNGTTOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=N2)C(=O)NC(=S)N3 |
Computed by PubChem (NCBI)