CAS 941868-64-0 is the registry number for 2-Amino-7-phenyl(1,3)thiazolo(4,5-d)pyridazin-4(5H)-one, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-amino-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one (CAS 941868-64-0) is a chemical compound with the molecular formula C11H8N4OS and a molecular weight of 244.27 g/mol. IUPAC name: 2-amino-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one. InChIKey: CKCOPPBCDQMNSE-UHFFFAOYSA-N.
| Molecular formula | C11H8N4OS |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2-amino-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one |
| InChIKey | CKCOPPBCDQMNSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=O)C3=C2SC(=N3)N |
Computed by PubChem (NCBI)