Products 107496-65-1
CAS 107496-65-1 is the registry number for 2-(2,4-Dichlorophenyl)-2-oxoethyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(2,4-dichlorophenyl)-2-oxoethyl] acetate (CAS 107496-65-1) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: [2-(2,4-dichlorophenyl)-2-oxoethyl] acetate. InChIKey: TVLYHTHOJUURLL-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | [2-(2,4-dichlorophenyl)-2-oxoethyl] acetate |
| InChIKey | TVLYHTHOJUURLL-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)