CAS 56719-68-7 is the registry number for Methyl 2',5'-dichlorobenzoylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 3-(2,5-dichlorophenyl)-3-oxopropanoate (CAS 56719-68-7) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: methyl 3-(2,5-dichlorophenyl)-3-oxopropanoate. InChIKey: MALONIFXTCFWPR-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | methyl 3-(2,5-dichlorophenyl)-3-oxopropanoate |
| InChIKey | MALONIFXTCFWPR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)