Products 24076-35-5
CAS 24076-35-5 appears in our catalog under these names: (E)-3-(3,5-Dichloro-4-methoxyphenyl)acrylic acid, 95%, 3-(3,5-Dichloro-4-methoxyphenyl)acrylic acid, ≥95%, (E)-3-(3,5-Dichloro-4-methoxyphenyl)acrylic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(E)-3-(3,5-dichloro-4-methoxyphenyl)prop-2-enoic acid (CAS 24076-35-5) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: (E)-3-(3,5-dichloro-4-methoxyphenyl)prop-2-enoic acid. InChIKey: XPMPKHNTDUSWCF-NSCUHMNNSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | (E)-3-(3,5-dichloro-4-methoxyphenyl)prop-2-enoic acid |
| InChIKey | XPMPKHNTDUSWCF-NSCUHMNNSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)