CAS 41727-45-1 is the registry number for 4-(Allyloxy)-3,5-dichlorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,5-dichloro-4-prop-2-enoxybenzoic acid (CAS 41727-45-1) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: 3,5-dichloro-4-prop-2-enoxybenzoic acid. InChIKey: RXLVKVUKUULKAK-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 3,5-dichloro-4-prop-2-enoxybenzoic acid |
| InChIKey | RXLVKVUKUULKAK-UHFFFAOYSA-N |
| SMILES | C=CCOC1=C(C=C(C=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)