CAS 166816-11-1 is the registry number for 1-(6,7-Dichloro-2,3-dihydro-1,4-benzodioxin-5-yl)-1-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(6,7-dichloro-2,3-dihydro-1,4-benzodioxin-5-yl)ethanone (CAS 166816-11-1) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: 1-(6,7-dichloro-2,3-dihydro-1,4-benzodioxin-5-yl)ethanone. InChIKey: IILYXHAHYKTHBH-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 1-(6,7-dichloro-2,3-dihydro-1,4-benzodioxin-5-yl)ethanone |
| InChIKey | IILYXHAHYKTHBH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=CC(=C1Cl)Cl)OCCO2 |
Computed by PubChem (NCBI)