Products 112520-27-1
CAS 112520-27-1 is the registry number for Methyl 3-(3,4-dichlorophenyl)-2-oxopropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(3,4-dichlorophenyl)-2-oxopropanoate (CAS 112520-27-1) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: methyl 3-(3,4-dichlorophenyl)-2-oxopropanoate. InChIKey: MAXJEZVVOFGKCV-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | methyl 3-(3,4-dichlorophenyl)-2-oxopropanoate |
| InChIKey | MAXJEZVVOFGKCV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)