Products 107516-75-6
CAS 107516-75-6 appears in our catalog under these names: Diethyl indole–2,6–dicarboxylate, Diethyl 1H-indole-2,6-dicarboxylate 97%, Diethyl 1H-indole-2,6-dicarboxylate, 97%, 97%, DIETHYL 1H-INDOLE-2,6-DICARBOXYLATE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
Diethyl 1H-indole-2,6-dicarboxylate (CAS 107516-75-6) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: diethyl 1H-indole-2,6-dicarboxylate. InChIKey: ISQYBMUDGXFHAF-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | diethyl 1H-indole-2,6-dicarboxylate |
| InChIKey | ISQYBMUDGXFHAF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=C(N2)C(=O)OCC |
Computed by PubChem (NCBI)