CAS 1075243-52-5 appears in our catalog under these names: 5-Chloro-2-(2,2,2-trifluoroethoxy)benzoic acid, 5-Chloro-2-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 2,5g, 5g, 1g.
5-chloro-2-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1075243-52-5) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: 5-chloro-2-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: QGMJKMPOLTZCNU-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 5-chloro-2-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | QGMJKMPOLTZCNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)