CAS 107657-57-8 is the registry number for (S)-Deoxy-thalidomide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 107657-57-8) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: (3S)-3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: WENKGSGGXGQHSH-JTQLQIEISA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | (3S)-3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | WENKGSGGXGQHSH-JTQLQIEISA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2CC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)