CAS 26581-81-7 appears in our catalog under these names: Thalidomide Impurity 1, EM-12/ 98.76% (existing batch purity), EM–12, 3-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione, 2-(2,6-Dioxopiperidin-3-yl)phthalimidine 98%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 26581-81-7) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: WENKGSGGXGQHSH-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | WENKGSGGXGQHSH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)