CAS 1078163-22-0 is the registry number for N-(3,5-Dichlorophenyl)pyrrolidine-2-carboxamide hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
N-(3,5-dichlorophenyl)pyrrolidine-2-carboxamide;hydrochloride (CAS 1078163-22-0) is a chemical compound with the molecular formula C11H13Cl3N2O and a molecular weight of 295.6 g/mol. IUPAC name: N-(3,5-dichlorophenyl)pyrrolidine-2-carboxamide;hydrochloride. InChIKey: YDYPNOVMNGLJGD-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl3N2O |
|---|---|
| Molecular weight | 295.6 g/mol |
| IUPAC name | N-(3,5-dichlorophenyl)pyrrolidine-2-carboxamide;hydrochloride |
| InChIKey | YDYPNOVMNGLJGD-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C(=O)NC2=CC(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)