Products 78302-26-8
CAS 78302-26-8 appears in our catalog under these names: Lofexidine-d4 Hydrochloride, >95% (HPLC), Lofexidine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5 mg, 1 mg.
4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole;hydrochloride (CAS 78302-26-8) is a chemical compound with the molecular formula C11H13Cl3N2O and a molecular weight of 299.6 g/mol. IUPAC name: 4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole;hydrochloride. InChIKey: DWWHMKBNNNZGHF-NXMSQKFDSA-N.
| Molecular formula | C11H13Cl3N2O |
|---|---|
| Molecular weight | 299.6 g/mol |
| IUPAC name | 4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole;hydrochloride |
| InChIKey | DWWHMKBNNNZGHF-NXMSQKFDSA-N |
| SMILES | [2H]C1(C(N=C(N1)C(C)OC2=C(C=CC=C2Cl)Cl)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)