CAS 1134449-64-1 is the registry number for 1-(3,5-Dichlorobenzoyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(3,5-dichlorophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1134449-64-1) is a chemical compound with the molecular formula C11H13Cl3N2O and a molecular weight of 295.6 g/mol. IUPAC name: (3,5-dichlorophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: WMSCFRBAMVLHPZ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl3N2O |
|---|---|
| Molecular weight | 295.6 g/mol |
| IUPAC name | (3,5-dichlorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | WMSCFRBAMVLHPZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)