CAS 1080-52-0 appears in our catalog under these names: 1-(2,4-Dimethylphenyl)-1h-pyrrole-2,5-dione, 95%, 1-(2,4-Dimethylphenyl)-1H-pyrrole-2,5-dione, 95+%, 1-(2,4-Dimethyl-phenyl)-pyrrole-2,5-dione, 1-(2,4-Dimethylphenyl)-1H-pyrrole-2,5-dione, 99%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg.
1-(2,4-dimethylphenyl)pyrrole-2,5-dione (CAS 1080-52-0) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)pyrrole-2,5-dione. InChIKey: LWFUFCYGHRBLDH-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| InChIKey | LWFUFCYGHRBLDH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=O)C=CC2=O)C |
Computed by PubChem (NCBI)