CAS 1082576-04-2 is the registry number for 2-(Phenoxymethyl)thiazole-4-carbaldehyde. Offered by: TRC. Available pack sizes: 2,5g.
2-(phenoxymethyl)-1,3-thiazole-4-carbaldehyde (CAS 1082576-04-2) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 2-(phenoxymethyl)-1,3-thiazole-4-carbaldehyde. InChIKey: LWFBPIWCVMQAMZ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 2-(phenoxymethyl)-1,3-thiazole-4-carbaldehyde |
| InChIKey | LWFBPIWCVMQAMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NC(=CS2)C=O |
Computed by PubChem (NCBI)