Products 1082942-70-8
CAS 1082942-70-8 is the registry number for CIB-L43, 99.71%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 100 mg, 50 mg, 25 mg.
4-methyl-2-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxylic acid (CAS 1082942-70-8) is a chemical compound with the molecular formula C15H16N2O3S and a molecular weight of 304.4 g/mol. IUPAC name: 4-methyl-2-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: IOTJAUCPIIEIOF-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O3S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 4-methyl-2-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | IOTJAUCPIIEIOF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=C(C=C2)N3CCOCC3)C(=O)O |
Computed by PubChem (NCBI)