CAS 108321-83-1 appears in our catalog under these names: H–DL–Phe–NH₂ · HCl, H-DL-Phe-NH2.HCl, 98%, 98%, 2-Amino-3-phenylpropanamide hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g.
2-amino-3-phenylpropanamide;hydrochloride (CAS 108321-83-1) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 2-amino-3-phenylpropanamide;hydrochloride. InChIKey: KLHLGTPNBQXSJT-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 2-amino-3-phenylpropanamide;hydrochloride |
| InChIKey | KLHLGTPNBQXSJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)N)N.Cl |
Computed by PubChem (NCBI)